C17H29N3O4 — CID 108916191
tert-butyl N-[2-[4-(3-methylbut-2-enoyl)-1,4-diazepan-1-yl]-2-oxoethyl]carbamate (PubChem CID 108916191) has the molecular formula C17H29N3O4 and a molecular weight of 339.44 g/mol. Its IUPAC name is tert-butyl N-[2-[4-(3-methylbut-2-enoyl)-1,4-diazepan-1-yl]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-(3-methylbut-2-enoyl)-1,4-diazepan-1-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108916191 |
| Molecular Formula | C17H29N3O4 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | tert-butyl N-[2-[4-(3-methylbut-2-enoyl)-1,4-diazepan-1-yl]-2-oxoethyl]carbamate |
| SMILES | CC(C)=CC(=O)N1CCCN(C(=O)CNC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C17H29N3O4/c1-13(2)11-14(21)19-7-6-8-20(10-9-19)15(22)12-18-16(23)24-17(3,4)5/h11H,6-10,12H2,1-5H3,(H,18,23) |
| InChIKey | CDTHUCPRKAMBRJ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|