C18H31N3O4 — CID 108916194
tert-butyl N-[2-[4-[(E)-4-methylpent-2-enoyl]-1,4-diazepan-1-yl]-2-oxoethyl]carbamate (PubChem CID 108916194) has the molecular formula C18H31N3O4 and a molecular weight of 353.46 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[(E)-4-methylpent-2-enoyl]-1,4-diazepan-1-yl]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[(E)-4-methylpent-2-enoyl]-1,4-diazepan-1-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108916194 |
| Molecular Formula | C18H31N3O4 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.23 |
| IUPAC Name | tert-butyl N-[2-[4-[(E)-4-methylpent-2-enoyl]-1,4-diazepan-1-yl]-2-oxoethyl]carbamate |
| SMILES | CC(C)/C=C/C(=O)N1CCCN(C(=O)CNC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C18H31N3O4/c1-14(2)7-8-15(22)20-9-6-10-21(12-11-20)16(23)13-19-17(24)25-18(3,4)5/h7-8,14H,6,9-13H2,1-5H3,(H,19,24)/b8-7+ |
| InChIKey | BHXNLMWBYFHVLD-BQYQJAHWSA-N |
| XLogP | 1.78 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|