C23H33N3O5 — CID 108919035
tert-butyl N-[3-[4-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]-1,4-diazepan-1-yl]-3-oxopropyl]carbamate (PubChem CID 108919035) has the molecular formula C23H33N3O5 and a molecular weight of 431.53 g/mol. Its IUPAC name is tert-butyl N-[3-[4-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]-1,4-diazepan-1-yl]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]-1,4-diazepan-1-yl]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 108919035 |
| Molecular Formula | C23H33N3O5 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | tert-butyl N-[3-[4-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]-1,4-diazepan-1-yl]-3-oxopropyl]carbamate |
| SMILES | COc1ccc(/C=C/C(=O)N2CCCN(C(=O)CCNC(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C23H33N3O5/c1-23(2,3)31-22(29)24-13-12-21(28)26-15-5-14-25(16-17-26)20(27)11-8-18-6-9-19(30-4)10-7-18/h6-11H,5,12-17H2,1-4H3,(H,24,29)/b11-8+ |
| InChIKey | SHHLOAVHDAQQOO-DHZHZOJOSA-N |
| XLogP | 2.68 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|