C22H31N3O5 — CID 108916837
tert-butyl N-[2-[[1-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]piperidin-4-yl]amino]-2-oxoethyl]carbamate (PubChem CID 108916837) has the molecular formula C22H31N3O5 and a molecular weight of 417.51 g/mol. Its IUPAC name is tert-butyl N-[2-[[1-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]piperidin-4-yl]amino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[1-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]piperidin-4-yl]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108916837 |
| Molecular Formula | C22H31N3O5 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | tert-butyl N-[2-[[1-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]piperidin-4-yl]amino]-2-oxoethyl]carbamate |
| SMILES | COc1ccc(/C=C/C(=O)N2CCC(NC(=O)CNC(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C22H31N3O5/c1-22(2,3)30-21(28)23-15-19(26)24-17-11-13-25(14-12-17)20(27)10-7-16-5-8-18(29-4)9-6-16/h5-10,17H,11-15H2,1-4H3,(H,23,28)(H,24,26)/b10-7+ |
| InChIKey | SDJDFQZPTQMDSW-JXMROGBWSA-N |
| XLogP | 2.34 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|