C22H32N2O6 — CID 55736349
tert-butyl N-[1-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]piperidin-4-yl]carbamate (PubChem CID 55736349) has the molecular formula C22H32N2O6 and a molecular weight of 420.51 g/mol. Its IUPAC name is tert-butyl N-[1-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 55736349 |
| Molecular Formula | C22H32N2O6 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | tert-butyl N-[1-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]piperidin-4-yl]carbamate |
| SMILES | COc1cc(/C=C/C(=O)N2CCC(NC(=O)OC(C)(C)C)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C22H32N2O6/c1-22(2,3)30-21(26)23-16-9-11-24(12-10-16)19(25)8-7-15-13-17(27-4)20(29-6)18(14-15)28-5/h7-8,13-14,16H,9-12H2,1-6H3,(H,23,26)/b8-7+ |
| InChIKey | FRHSRZXYKHPLEN-BQYQJAHWSA-N |
| XLogP | 3.24 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|