C20H30N2O6 — CID 55736285
tert-butyl N-[1-(3,4,5-trimethoxybenzoyl)piperidin-4-yl]carbamate (PubChem CID 55736285) has the molecular formula C20H30N2O6 and a molecular weight of 394.47 g/mol. Its IUPAC name is tert-butyl N-[1-(3,4,5-trimethoxybenzoyl)piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-(3,4,5-trimethoxybenzoyl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 55736285 |
| Molecular Formula | C20H30N2O6 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | tert-butyl N-[1-(3,4,5-trimethoxybenzoyl)piperidin-4-yl]carbamate |
| SMILES | COc1cc(C(=O)N2CCC(NC(=O)OC(C)(C)C)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C20H30N2O6/c1-20(2,3)28-19(24)21-14-7-9-22(10-8-14)18(23)13-11-15(25-4)17(27-6)16(12-13)26-5/h11-12,14H,7-10H2,1-6H3,(H,21,24) |
| InChIKey | LQAFMDMMXCGBQH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |