C26H34N2O6 — CID 55736788
tert-butyl N-[1-(3,5-dimethoxy-4-phenylmethoxybenzoyl)piperidin-4-yl]carbamate (PubChem CID 55736788) has the molecular formula C26H34N2O6 and a molecular weight of 470.57 g/mol. Its IUPAC name is tert-butyl N-[1-(3,5-dimethoxy-4-phenylmethoxybenzoyl)piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-(3,5-dimethoxy-4-phenylmethoxybenzoyl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 55736788 |
| Molecular Formula | C26H34N2O6 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | tert-butyl N-[1-(3,5-dimethoxy-4-phenylmethoxybenzoyl)piperidin-4-yl]carbamate |
| SMILES | COc1cc(C(=O)N2CCC(NC(=O)OC(C)(C)C)CC2)cc(OC)c1OCc1ccccc1 |
| InChI | InChI=1S/C26H34N2O6/c1-26(2,3)34-25(30)27-20-11-13-28(14-12-20)24(29)19-15-21(31-4)23(22(16-19)32-5)33-17-18-9-7-6-8-10-18/h6-10,15-16,20H,11-14,17H2,1-5H3,(H,27,30) |
| InChIKey | SWLUPXUDOADEQZ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |