C25H30N2O5 — CID 56511756
cyclobutyl-[4-(3,5-dimethoxy-4-phenylmethoxybenzoyl)piperazin-1-yl]methanone (PubChem CID 56511756) has the molecular formula C25H30N2O5 and a molecular weight of 438.52 g/mol. Its IUPAC name is cyclobutyl-[4-(3,5-dimethoxy-4-phenylmethoxybenzoyl)piperazin-1-yl]methanone.
| Compound Name | cyclobutyl-[4-(3,5-dimethoxy-4-phenylmethoxybenzoyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 56511756 |
| Molecular Formula | C25H30N2O5 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | cyclobutyl-[4-(3,5-dimethoxy-4-phenylmethoxybenzoyl)piperazin-1-yl]methanone |
| SMILES | COc1cc(C(=O)N2CCN(C(=O)C3CCC3)CC2)cc(OC)c1OCc1ccccc1 |
| InChI | InChI=1S/C25H30N2O5/c1-30-21-15-20(16-22(31-2)23(21)32-17-18-7-4-3-5-8-18)25(29)27-13-11-26(12-14-27)24(28)19-9-6-10-19/h3-5,7-8,15-16,19H,6,9-14,17H2,1-2H3 |
| InChIKey | NVOZASXFNOGZPQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |