C22H32N2O5 — CID 56510742
cyclobutyl-[4-(3,4,5-triethoxybenzoyl)piperazin-1-yl]methanone (PubChem CID 56510742) has the molecular formula C22H32N2O5 and a molecular weight of 404.51 g/mol. Its IUPAC name is cyclobutyl-[4-(3,4,5-triethoxybenzoyl)piperazin-1-yl]methanone.
| Compound Name | cyclobutyl-[4-(3,4,5-triethoxybenzoyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 56510742 |
| Molecular Formula | C22H32N2O5 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | cyclobutyl-[4-(3,4,5-triethoxybenzoyl)piperazin-1-yl]methanone |
| SMILES | CCOc1cc(C(=O)N2CCN(C(=O)C3CCC3)CC2)cc(OCC)c1OCC |
| InChI | InChI=1S/C22H32N2O5/c1-4-27-18-14-17(15-19(28-5-2)20(18)29-6-3)22(26)24-12-10-23(11-13-24)21(25)16-8-7-9-16/h14-16H,4-13H2,1-3H3 |
| InChIKey | KKRCJASHUKHSFS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |