C22H32N2O6 — CID 108534384
1-[4-(3,4,5-triethoxybenzoyl)piperazin-1-yl]pentane-1,4-dione (PubChem CID 108534384) has the molecular formula C22H32N2O6 and a molecular weight of 420.51 g/mol. Its IUPAC name is 1-[4-(3,4,5-triethoxybenzoyl)piperazin-1-yl]pentane-1,4-dione.
| Compound Name | 1-[4-(3,4,5-triethoxybenzoyl)piperazin-1-yl]pentane-1,4-dione |
|---|---|
| PubChem CID | 108534384 |
| Molecular Formula | C22H32N2O6 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 1-[4-(3,4,5-triethoxybenzoyl)piperazin-1-yl]pentane-1,4-dione |
| SMILES | CCOc1cc(C(=O)N2CCN(C(=O)CCC(C)=O)CC2)cc(OCC)c1OCC |
| InChI | InChI=1S/C22H32N2O6/c1-5-28-18-14-17(15-19(29-6-2)21(18)30-7-3)22(27)24-12-10-23(11-13-24)20(26)9-8-16(4)25/h14-15H,5-13H2,1-4H3 |
| InChIKey | XTLMPMXFPIDVCC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |