C23H29ClN2O4 — CID 1116272
[4-(3-chlorophenyl)piperazin-1-yl]-(3,4,5-triethoxyphenyl)methanone (PubChem CID 1116272) has the molecular formula C23H29ClN2O4 and a molecular weight of 432.95 g/mol. Its IUPAC name is [4-(3-chlorophenyl)piperazin-1-yl]-(3,4,5-triethoxyphenyl)methanone.
| Compound Name | [4-(3-chlorophenyl)piperazin-1-yl]-(3,4,5-triethoxyphenyl)methanone |
|---|---|
| PubChem CID | 1116272 |
| Molecular Formula | C23H29ClN2O4 |
| Molecular Weight | 432.95 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | [4-(3-chlorophenyl)piperazin-1-yl]-(3,4,5-triethoxyphenyl)methanone |
| SMILES | CCOc1cc(C(=O)N2CCN(c3cccc(Cl)c3)CC2)cc(OCC)c1OCC |
| InChI | InChI=1S/C23H29ClN2O4/c1-4-28-20-14-17(15-21(29-5-2)22(20)30-6-3)23(27)26-12-10-25(11-13-26)19-9-7-8-18(24)16-19/h7-9,14-16H,4-6,10-13H2,1-3H3 |
| InChIKey | PMTRJMPUEGREJQ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.95 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |