C21H32N2O5 — CID 108567965
1-[4-(3,4,5-triethoxybenzoyl)piperazin-1-yl]butan-1-one (PubChem CID 108567965) has the molecular formula C21H32N2O5 and a molecular weight of 392.50 g/mol. Its IUPAC name is 1-[4-(3,4,5-triethoxybenzoyl)piperazin-1-yl]butan-1-one.
| Compound Name | 1-[4-(3,4,5-triethoxybenzoyl)piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 108567965 |
| Molecular Formula | C21H32N2O5 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | 1-[4-(3,4,5-triethoxybenzoyl)piperazin-1-yl]butan-1-one |
| SMILES | CCCC(=O)N1CCN(C(=O)c2cc(OCC)c(OCC)c(OCC)c2)CC1 |
| InChI | InChI=1S/C21H32N2O5/c1-5-9-19(24)22-10-12-23(13-11-22)21(25)16-14-17(26-6-2)20(28-8-4)18(15-16)27-7-3/h14-15H,5-13H2,1-4H3 |
| InChIKey | PWXAFBNDSCOMHQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |