C20H28Cl2N2O5 — CID 108564107
2,2-dichloro-N-[1-(3,4,5-triethoxybenzoyl)piperidin-4-yl]acetamide (PubChem CID 108564107) has the molecular formula C20H28Cl2N2O5 and a molecular weight of 447.36 g/mol. Its IUPAC name is 2,2-dichloro-N-[1-(3,4,5-triethoxybenzoyl)piperidin-4-yl]acetamide.
| Compound Name | 2,2-dichloro-N-[1-(3,4,5-triethoxybenzoyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 108564107 |
| Molecular Formula | C20H28Cl2N2O5 |
| Molecular Weight | 447.36 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 2,2-dichloro-N-[1-(3,4,5-triethoxybenzoyl)piperidin-4-yl]acetamide |
| SMILES | CCOc1cc(C(=O)N2CCC(NC(=O)C(Cl)Cl)CC2)cc(OCC)c1OCC |
| InChI | InChI=1S/C20H28Cl2N2O5/c1-4-27-15-11-13(12-16(28-5-2)17(15)29-6-3)20(26)24-9-7-14(8-10-24)23-19(25)18(21)22/h11-12,14,18H,4-10H2,1-3H3,(H,23,25) |
| InChIKey | UGJHABWWZQKDAE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|