C23H30N4O5 — CID 108550660
3,4,5-triethoxy-N-[1-(pyrazine-2-carbonyl)piperidin-4-yl]benzamide (PubChem CID 108550660) has the molecular formula C23H30N4O5 and a molecular weight of 442.52 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[1-(pyrazine-2-carbonyl)piperidin-4-yl]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[1-(pyrazine-2-carbonyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 108550660 |
| Molecular Formula | C23H30N4O5 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | 3,4,5-triethoxy-N-[1-(pyrazine-2-carbonyl)piperidin-4-yl]benzamide |
| SMILES | CCOc1cc(C(=O)NC2CCN(C(=O)c3cnccn3)CC2)cc(OCC)c1OCC |
| InChI | InChI=1S/C23H30N4O5/c1-4-30-19-13-16(14-20(31-5-2)21(19)32-6-3)22(28)26-17-7-11-27(12-8-17)23(29)18-15-24-9-10-25-18/h9-10,13-15,17H,4-8,11-12H2,1-3H3,(H,26,28) |
| InChIKey | TWYHLJKMWPBNEX-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 102.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |