C20H30N2O6 — CID 108564110
methyl N-[1-(3,4,5-triethoxybenzoyl)piperidin-4-yl]carbamate (PubChem CID 108564110) has the molecular formula C20H30N2O6 and a molecular weight of 394.47 g/mol. Its IUPAC name is methyl N-[1-(3,4,5-triethoxybenzoyl)piperidin-4-yl]carbamate.
| Compound Name | methyl N-[1-(3,4,5-triethoxybenzoyl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 108564110 |
| Molecular Formula | C20H30N2O6 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | methyl N-[1-(3,4,5-triethoxybenzoyl)piperidin-4-yl]carbamate |
| SMILES | CCOc1cc(C(=O)N2CCC(NC(=O)OC)CC2)cc(OCC)c1OCC |
| InChI | InChI=1S/C20H30N2O6/c1-5-26-16-12-14(13-17(27-6-2)18(16)28-7-3)19(23)22-10-8-15(9-11-22)21-20(24)25-4/h12-13,15H,5-11H2,1-4H3,(H,21,24) |
| InChIKey | YJKCLXQCZYNZRE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |