C21H33N3O5 — CID 108564112
1,1-dimethyl-3-[1-(3,4,5-triethoxybenzoyl)piperidin-4-yl]urea (PubChem CID 108564112) has the molecular formula C21H33N3O5 and a molecular weight of 407.51 g/mol. Its IUPAC name is 1,1-dimethyl-3-[1-(3,4,5-triethoxybenzoyl)piperidin-4-yl]urea.
| Compound Name | 1,1-dimethyl-3-[1-(3,4,5-triethoxybenzoyl)piperidin-4-yl]urea |
|---|---|
| PubChem CID | 108564112 |
| Molecular Formula | C21H33N3O5 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | 1,1-dimethyl-3-[1-(3,4,5-triethoxybenzoyl)piperidin-4-yl]urea |
| SMILES | CCOc1cc(C(=O)N2CCC(NC(=O)N(C)C)CC2)cc(OCC)c1OCC |
| InChI | InChI=1S/C21H33N3O5/c1-6-27-17-13-15(14-18(28-7-2)19(17)29-8-3)20(25)24-11-9-16(10-12-24)22-21(26)23(4)5/h13-14,16H,6-12H2,1-5H3,(H,22,26) |
| InChIKey | YHGVXLIEZDNEEM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |