C18H27ClN2O3 — CID 119560795
(3-chloro-5-ethoxy-4-propoxyphenyl)-[4-(methylamino)piperidin-1-yl]methanone (PubChem CID 119560795) has the molecular formula C18H27ClN2O3 and a molecular weight of 354.88 g/mol. Its IUPAC name is (3-chloro-5-ethoxy-4-propoxyphenyl)-[4-(methylamino)piperidin-1-yl]methanone.
| Compound Name | (3-chloro-5-ethoxy-4-propoxyphenyl)-[4-(methylamino)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 119560795 |
| Molecular Formula | C18H27ClN2O3 |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | (3-chloro-5-ethoxy-4-propoxyphenyl)-[4-(methylamino)piperidin-1-yl]methanone |
| SMILES | CCCOc1c(Cl)cc(C(=O)N2CCC(NC)CC2)cc1OCC |
| InChI | InChI=1S/C18H27ClN2O3/c1-4-10-24-17-15(19)11-13(12-16(17)23-5-2)18(22)21-8-6-14(20-3)7-9-21/h11-12,14,20H,4-10H2,1-3H3 |
| InChIKey | OBUPPDBMWATHFO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |