C20H31ClN2O3 — CID 119518487
[4-(1-aminoethyl)piperidin-1-yl]-(4-butoxy-3-chloro-5-ethoxyphenyl)methanone (PubChem CID 119518487) has the molecular formula C20H31ClN2O3 and a molecular weight of 382.93 g/mol. Its IUPAC name is [4-(1-aminoethyl)piperidin-1-yl]-(4-butoxy-3-chloro-5-ethoxyphenyl)methanone.
| Compound Name | [4-(1-aminoethyl)piperidin-1-yl]-(4-butoxy-3-chloro-5-ethoxyphenyl)methanone |
|---|---|
| PubChem CID | 119518487 |
| Molecular Formula | C20H31ClN2O3 |
| Molecular Weight | 382.93 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | [4-(1-aminoethyl)piperidin-1-yl]-(4-butoxy-3-chloro-5-ethoxyphenyl)methanone |
| SMILES | CCCCOc1c(Cl)cc(C(=O)N2CCC(C(C)N)CC2)cc1OCC |
| InChI | InChI=1S/C20H31ClN2O3/c1-4-6-11-26-19-17(21)12-16(13-18(19)25-5-2)20(24)23-9-7-15(8-10-23)14(3)22/h12-15H,4-11,22H2,1-3H3 |
| InChIKey | YULWKLVYCITCBM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.93 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|