C20H32Cl2N2O4 — CID 119662351
[4-(3-aminopropoxy)piperidin-1-yl]-(3-chloro-5-ethoxy-4-propoxyphenyl)methanone;hydrochloride (PubChem CID 119662351) has the molecular formula C20H32Cl2N2O4 and a molecular weight of 435.39 g/mol. Its IUPAC name is [4-(3-aminopropoxy)piperidin-1-yl]-(3-chloro-5-ethoxy-4-propoxyphenyl)methanone;hydrochloride.
| Compound Name | [4-(3-aminopropoxy)piperidin-1-yl]-(3-chloro-5-ethoxy-4-propoxyphenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119662351 |
| Molecular Formula | C20H32Cl2N2O4 |
| Molecular Weight | 435.39 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | [4-(3-aminopropoxy)piperidin-1-yl]-(3-chloro-5-ethoxy-4-propoxyphenyl)methanone;hydrochloride |
| SMILES | CCCOc1c(Cl)cc(C(=O)N2CCC(OCCCN)CC2)cc1OCC.Cl |
| InChI | InChI=1S/C20H31ClN2O4.ClH/c1-3-11-27-19-17(21)13-15(14-18(19)25-4-2)20(24)23-9-6-16(7-10-23)26-12-5-8-22;/h13-14,16H,3-12,22H2,1-2H3;1H |
| InChIKey | PHSUSVHWZSQXKN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.39 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|