C20H31ClN2O4 — CID 119664059
[4-(3-aminopropoxy)piperidin-1-yl]-(4-butoxy-3-chloro-5-methoxyphenyl)methanone (PubChem CID 119664059) has the molecular formula C20H31ClN2O4 and a molecular weight of 398.93 g/mol. Its IUPAC name is [4-(3-aminopropoxy)piperidin-1-yl]-(4-butoxy-3-chloro-5-methoxyphenyl)methanone.
| Compound Name | [4-(3-aminopropoxy)piperidin-1-yl]-(4-butoxy-3-chloro-5-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 119664059 |
| Molecular Formula | C20H31ClN2O4 |
| Molecular Weight | 398.93 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | [4-(3-aminopropoxy)piperidin-1-yl]-(4-butoxy-3-chloro-5-methoxyphenyl)methanone |
| SMILES | CCCCOc1c(Cl)cc(C(=O)N2CCC(OCCCN)CC2)cc1OC |
| InChI | InChI=1S/C20H31ClN2O4/c1-3-4-11-27-19-17(21)13-15(14-18(19)25-2)20(24)23-9-6-16(7-10-23)26-12-5-8-22/h13-14,16H,3-12,22H2,1-2H3 |
| InChIKey | FFVHAMLHINPQSR-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.93 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|