C16H22ClNO3 — CID 78768166
(3-chloro-4-ethoxy-5-methoxyphenyl)-(4-methylpiperidin-1-yl)methanone (PubChem CID 78768166) has the molecular formula C16H22ClNO3 and a molecular weight of 311.81 g/mol. Its IUPAC name is (3-chloro-4-ethoxy-5-methoxyphenyl)-(4-methylpiperidin-1-yl)methanone.
| Compound Name | (3-chloro-4-ethoxy-5-methoxyphenyl)-(4-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 78768166 |
| Molecular Formula | C16H22ClNO3 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | (3-chloro-4-ethoxy-5-methoxyphenyl)-(4-methylpiperidin-1-yl)methanone |
| SMILES | CCOc1c(Cl)cc(C(=O)N2CCC(C)CC2)cc1OC |
| InChI | InChI=1S/C16H22ClNO3/c1-4-21-15-13(17)9-12(10-14(15)20-3)16(19)18-7-5-11(2)6-8-18/h9-11H,4-8H2,1-3H3 |
| InChIKey | KGMVYESPXBURBN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |