C19H26ClNO5 — CID 122119227
1-(4-butoxy-3-chloro-5-methoxybenzoyl)-5-methylpiperidine-3-carboxylic acid (PubChem CID 122119227) has the molecular formula C19H26ClNO5 and a molecular weight of 383.87 g/mol. Its IUPAC name is 1-(4-butoxy-3-chloro-5-methoxybenzoyl)-5-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-(4-butoxy-3-chloro-5-methoxybenzoyl)-5-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122119227 |
| Molecular Formula | C19H26ClNO5 |
| Molecular Weight | 383.87 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 1-(4-butoxy-3-chloro-5-methoxybenzoyl)-5-methylpiperidine-3-carboxylic acid |
| SMILES | CCCCOc1c(Cl)cc(C(=O)N2CC(C)CC(C(=O)O)C2)cc1OC |
| InChI | InChI=1S/C19H26ClNO5/c1-4-5-6-26-17-15(20)8-13(9-16(17)25-3)18(22)21-10-12(2)7-14(11-21)19(23)24/h8-9,12,14H,4-7,10-11H2,1-3H3,(H,23,24) |
| InChIKey | ZYZBLDQWUUVEIW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.87 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|