C19H26ClNO5 — CID 119113443
(3S)-1-[3-chloro-5-methoxy-4-(3-methylbutoxy)benzoyl]piperidine-3-carboxylic acid (PubChem CID 119113443) has the molecular formula C19H26ClNO5 and a molecular weight of 383.87 g/mol. Its IUPAC name is (3S)-1-[3-chloro-5-methoxy-4-(3-methylbutoxy)benzoyl]piperidine-3-carboxylic acid.
| Compound Name | (3S)-1-[3-chloro-5-methoxy-4-(3-methylbutoxy)benzoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 119113443 |
| Molecular Formula | C19H26ClNO5 |
| Molecular Weight | 383.87 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | (3S)-1-[3-chloro-5-methoxy-4-(3-methylbutoxy)benzoyl]piperidine-3-carboxylic acid |
| SMILES | COc1cc(C(=O)N2CCC[C@H](C(=O)O)C2)cc(Cl)c1OCCC(C)C |
| InChI | InChI=1S/C19H26ClNO5/c1-12(2)6-8-26-17-15(20)9-14(10-16(17)25-3)18(22)21-7-4-5-13(11-21)19(23)24/h9-10,12-13H,4-8,11H2,1-3H3,(H,23,24)/t13-/m0/s1 |
| InChIKey | AOMGVEBHFLLEHP-ZDUSSCGKSA-N |
| XLogP | 3.71 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.87 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |