C18H27ClN2O3 — CID 112759581
[3-chloro-5-methoxy-4-(3-methylbutoxy)phenyl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 112759581) has the molecular formula C18H27ClN2O3 and a molecular weight of 354.88 g/mol. Its IUPAC name is [3-chloro-5-methoxy-4-(3-methylbutoxy)phenyl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [3-chloro-5-methoxy-4-(3-methylbutoxy)phenyl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 112759581 |
| Molecular Formula | C18H27ClN2O3 |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | [3-chloro-5-methoxy-4-(3-methylbutoxy)phenyl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | COc1cc(C(=O)N2CCN(C)CC2)cc(Cl)c1OCCC(C)C |
| InChI | InChI=1S/C18H27ClN2O3/c1-13(2)5-10-24-17-15(19)11-14(12-16(17)23-4)18(22)21-8-6-20(3)7-9-21/h11-13H,5-10H2,1-4H3 |
| InChIKey | CXFDCBNFXNDLBC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |