C19H28Cl2N2O3 — CID 120659326
[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[3-chloro-5-methoxy-4-(3-methylbutoxy)phenyl]methanone;hydrochloride (PubChem CID 120659326) has the molecular formula C19H28Cl2N2O3 and a molecular weight of 403.35 g/mol. Its IUPAC name is [(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[3-chloro-5-methoxy-4-(3-methylbutoxy)phenyl]methanone;hydrochloride.
| Compound Name | [(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[3-chloro-5-methoxy-4-(3-methylbutoxy)phenyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 120659326 |
| Molecular Formula | C19H28Cl2N2O3 |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | [(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[3-chloro-5-methoxy-4-(3-methylbutoxy)phenyl]methanone;hydrochloride |
| SMILES | COc1cc(C(=O)N2C[C@H]3CNC[C@H]3C2)cc(Cl)c1OCCC(C)C.Cl |
| InChI | InChI=1S/C19H27ClN2O3.ClH/c1-12(2)4-5-25-18-16(20)6-13(7-17(18)24-3)19(23)22-10-14-8-21-9-15(14)11-22;/h6-7,12,14-15,21H,4-5,8-11H2,1-3H3;1H/t14-,15+; |
| InChIKey | XNYYDFJBKXNSKE-KBGJBQQCSA-N |
| XLogP | 3.49 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |