C17H22ClNO5 — CID 30880442
ethyl (3R)-1-(3-chloro-4,5-dimethoxybenzoyl)piperidine-3-carboxylate (PubChem CID 30880442) has the molecular formula C17H22ClNO5 and a molecular weight of 355.82 g/mol. Its IUPAC name is ethyl (3R)-1-(3-chloro-4,5-dimethoxybenzoyl)piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-(3-chloro-4,5-dimethoxybenzoyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 30880442 |
| Molecular Formula | C17H22ClNO5 |
| Molecular Weight | 355.82 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | ethyl (3R)-1-(3-chloro-4,5-dimethoxybenzoyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(C(=O)c2cc(Cl)c(OC)c(OC)c2)C1 |
| InChI | InChI=1S/C17H22ClNO5/c1-4-24-17(21)11-6-5-7-19(10-11)16(20)12-8-13(18)15(23-3)14(9-12)22-2/h8-9,11H,4-7,10H2,1-3H3/t11-/m1/s1 |
| InChIKey | ZWZZDNNCZUZPTC-LLVKDONJSA-N |
| XLogP | 2.77 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.82 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |