C16H19Cl2NO4 — CID 52510977
ethyl (3S)-1-(3,5-dichloro-4-methoxybenzoyl)piperidine-3-carboxylate (PubChem CID 52510977) has the molecular formula C16H19Cl2NO4 and a molecular weight of 360.24 g/mol. Its IUPAC name is ethyl (3S)-1-(3,5-dichloro-4-methoxybenzoyl)piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-(3,5-dichloro-4-methoxybenzoyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 52510977 |
| Molecular Formula | C16H19Cl2NO4 |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | ethyl (3S)-1-(3,5-dichloro-4-methoxybenzoyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN(C(=O)c2cc(Cl)c(OC)c(Cl)c2)C1 |
| InChI | InChI=1S/C16H19Cl2NO4/c1-3-23-16(21)10-5-4-6-19(9-10)15(20)11-7-12(17)14(22-2)13(18)8-11/h7-8,10H,3-6,9H2,1-2H3/t10-/m0/s1 |
| InChIKey | ILTJJUADBKDCPH-JTQLQIEISA-N |
| XLogP | 3.42 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |