C16H20ClNO3 — CID 107098532
ethyl (3R)-1-(3-chloro-2-methylbenzoyl)piperidine-3-carboxylate (PubChem CID 107098532) has the molecular formula C16H20ClNO3 and a molecular weight of 309.79 g/mol. Its IUPAC name is ethyl (3R)-1-(3-chloro-2-methylbenzoyl)piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-(3-chloro-2-methylbenzoyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 107098532 |
| Molecular Formula | C16H20ClNO3 |
| Molecular Weight | 309.79 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | ethyl (3R)-1-(3-chloro-2-methylbenzoyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(C(=O)c2cccc(Cl)c2C)C1 |
| InChI | InChI=1S/C16H20ClNO3/c1-3-21-16(20)12-6-5-9-18(10-12)15(19)13-7-4-8-14(17)11(13)2/h4,7-8,12H,3,5-6,9-10H2,1-2H3/t12-/m1/s1 |
| InChIKey | MQNLYRDJYJBRFL-GFCCVEGCSA-N |
| XLogP | 3.06 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.79 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |