C16H21NO3S — CID 81338642
ethyl (3R)-1-(2-methylsulfanylbenzoyl)piperidine-3-carboxylate (PubChem CID 81338642) has the molecular formula C16H21NO3S and a molecular weight of 307.41 g/mol. Its IUPAC name is ethyl (3R)-1-(2-methylsulfanylbenzoyl)piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-(2-methylsulfanylbenzoyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 81338642 |
| Molecular Formula | C16H21NO3S |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | ethyl (3R)-1-(2-methylsulfanylbenzoyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(C(=O)c2ccccc2SC)C1 |
| InChI | InChI=1S/C16H21NO3S/c1-3-20-16(19)12-7-6-10-17(11-12)15(18)13-8-4-5-9-14(13)21-2/h4-5,8-9,12H,3,6-7,10-11H2,1-2H3/t12-/m1/s1 |
| InChIKey | LPSVYQLJRILXPQ-GFCCVEGCSA-N |
| XLogP | 2.82 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |