C17H22N2O4S — CID 55526839
ethyl 1-[2-(2-amino-2-oxoethyl)sulfanylbenzoyl]piperidine-3-carboxylate (PubChem CID 55526839) has the molecular formula C17H22N2O4S and a molecular weight of 350.44 g/mol. Its IUPAC name is ethyl 1-[2-(2-amino-2-oxoethyl)sulfanylbenzoyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[2-(2-amino-2-oxoethyl)sulfanylbenzoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 55526839 |
| Molecular Formula | C17H22N2O4S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | ethyl 1-[2-(2-amino-2-oxoethyl)sulfanylbenzoyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)c2ccccc2SCC(N)=O)C1 |
| InChI | InChI=1S/C17H22N2O4S/c1-2-23-17(22)12-6-5-9-19(10-12)16(21)13-7-3-4-8-14(13)24-11-15(18)20/h3-4,7-8,12H,2,5-6,9-11H2,1H3,(H2,18,20) |
| InChIKey | MJVFJADVKKXXNO-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |