C17H24N6O3 — CID 168604204
ethyl 1-[2-[[amino-(diaminomethylideneamino)methylidene]amino]benzoyl]piperidine-3-carboxylate (PubChem CID 168604204) has the molecular formula C17H24N6O3 and a molecular weight of 360.42 g/mol. Its IUPAC name is ethyl 1-[2-[[amino-(diaminomethylideneamino)methylidene]amino]benzoyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[2-[[amino-(diaminomethylideneamino)methylidene]amino]benzoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 168604204 |
| Molecular Formula | C17H24N6O3 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | ethyl 1-[2-[[amino-(diaminomethylideneamino)methylidene]amino]benzoyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)c2ccccc2/N=C(\N)N=C(N)N)C1 |
| InChI | InChI=1S/C17H24N6O3/c1-2-26-15(25)11-6-5-9-23(10-11)14(24)12-7-3-4-8-13(12)21-17(20)22-16(18)19/h3-4,7-8,11H,2,5-6,9-10H2,1H3,(H6,18,19,20,21,22) |
| InChIKey | UJVIKEMFMWANIH-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 149.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|