C16H22N2O5S — CID 51163973
ethyl 1-[2-(methanesulfonamido)benzoyl]piperidine-3-carboxylate (PubChem CID 51163973) has the molecular formula C16H22N2O5S and a molecular weight of 354.43 g/mol. Its IUPAC name is ethyl 1-[2-(methanesulfonamido)benzoyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[2-(methanesulfonamido)benzoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 51163973 |
| Molecular Formula | C16H22N2O5S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | ethyl 1-[2-(methanesulfonamido)benzoyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)c2ccccc2NS(C)(=O)=O)C1 |
| InChI | InChI=1S/C16H22N2O5S/c1-3-23-16(20)12-7-6-10-18(11-12)15(19)13-8-4-5-9-14(13)17-24(2,21)22/h4-5,8-9,12,17H,3,6-7,10-11H2,1-2H3 |
| InChIKey | CJRAPNFSLKERDX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |