C21H23NO3 — CID 39950024
ethyl (3R)-1-(2-phenylbenzoyl)piperidine-3-carboxylate (PubChem CID 39950024) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is ethyl (3R)-1-(2-phenylbenzoyl)piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-(2-phenylbenzoyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 39950024 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | ethyl (3R)-1-(2-phenylbenzoyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(C(=O)c2ccccc2-c2ccccc2)C1 |
| InChI | InChI=1S/C21H23NO3/c1-2-25-21(24)17-11-8-14-22(15-17)20(23)19-13-7-6-12-18(19)16-9-4-3-5-10-16/h3-7,9-10,12-13,17H,2,8,11,14-15H2,1H3/t17-/m1/s1 |
| InChIKey | XEMZEBOAGZBZCL-QGZVFWFLSA-N |
| XLogP | 3.77 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |