C24H24N2O3 — CID 40547748
ethyl (3R)-1-(2-phenylquinoline-4-carbonyl)piperidine-3-carboxylate (PubChem CID 40547748) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is ethyl (3R)-1-(2-phenylquinoline-4-carbonyl)piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-(2-phenylquinoline-4-carbonyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 40547748 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | ethyl (3R)-1-(2-phenylquinoline-4-carbonyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(C(=O)c2cc(-c3ccccc3)nc3ccccc23)C1 |
| InChI | InChI=1S/C24H24N2O3/c1-2-29-24(28)18-11-8-14-26(16-18)23(27)20-15-22(17-9-4-3-5-10-17)25-21-13-7-6-12-19(20)21/h3-7,9-10,12-13,15,18H,2,8,11,14,16H2,1H3/t18-/m1/s1 |
| InChIKey | CFFXEJKBQKFPQA-GOSISDBHSA-N |
| XLogP | 4.32 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |