C24H23FN2O3 — CID 7745228
ethyl (3R)-1-[2-(4-fluorophenyl)quinoline-4-carbonyl]piperidine-3-carboxylate (PubChem CID 7745228) has the molecular formula C24H23FN2O3 and a molecular weight of 406.46 g/mol. Its IUPAC name is ethyl (3R)-1-[2-(4-fluorophenyl)quinoline-4-carbonyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-[2-(4-fluorophenyl)quinoline-4-carbonyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 7745228 |
| Molecular Formula | C24H23FN2O3 |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | ethyl (3R)-1-[2-(4-fluorophenyl)quinoline-4-carbonyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(C(=O)c2cc(-c3ccc(F)cc3)nc3ccccc23)C1 |
| InChI | InChI=1S/C24H23FN2O3/c1-2-30-24(29)17-6-5-13-27(15-17)23(28)20-14-22(16-9-11-18(25)12-10-16)26-21-8-4-3-7-19(20)21/h3-4,7-12,14,17H,2,5-6,13,15H2,1H3/t17-/m1/s1 |
| InChIKey | FCDUSFRVAAEUNB-QGZVFWFLSA-N |
| XLogP | 4.46 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |