C22H20N2O3 — CID 133108166
1-(2-phenylquinoline-4-carbonyl)piperidine-3-carboxylic acid (PubChem CID 133108166) has the molecular formula C22H20N2O3 and a molecular weight of 360.41 g/mol. Its IUPAC name is 1-(2-phenylquinoline-4-carbonyl)piperidine-3-carboxylic acid.
| Compound Name | 1-(2-phenylquinoline-4-carbonyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 133108166 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 1-(2-phenylquinoline-4-carbonyl)piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(C(=O)c2cc(-c3ccccc3)nc3ccccc23)C1 |
| InChI | InChI=1S/C22H20N2O3/c25-21(24-12-6-9-16(14-24)22(26)27)18-13-20(15-7-2-1-3-8-15)23-19-11-5-4-10-17(18)19/h1-5,7-8,10-11,13,16H,6,9,12,14H2,(H,26,27) |
| InChIKey | UZBOGHJVGMDGLN-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |