C22H21BrN2O — CID 40543105
[2-(3-bromophenyl)quinolin-4-yl]-[(3R)-3-methylpiperidin-1-yl]methanone (PubChem CID 40543105) has the molecular formula C22H21BrN2O and a molecular weight of 409.33 g/mol. Its IUPAC name is [2-(3-bromophenyl)quinolin-4-yl]-[(3R)-3-methylpiperidin-1-yl]methanone.
| Compound Name | [2-(3-bromophenyl)quinolin-4-yl]-[(3R)-3-methylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 40543105 |
| Molecular Formula | C22H21BrN2O |
| Molecular Weight | 409.33 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | [2-(3-bromophenyl)quinolin-4-yl]-[(3R)-3-methylpiperidin-1-yl]methanone |
| SMILES | C[C@@H]1CCCN(C(=O)c2cc(-c3cccc(Br)c3)nc3ccccc23)C1 |
| InChI | InChI=1S/C22H21BrN2O/c1-15-6-5-11-25(14-15)22(26)19-13-21(16-7-4-8-17(23)12-16)24-20-10-3-2-9-18(19)20/h2-4,7-10,12-13,15H,5-6,11,14H2,1H3/t15-/m1/s1 |
| InChIKey | OPNZENHKMVKVTH-OAHLLOKOSA-N |
| XLogP | 5.54 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.33 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |