C20H22Cl2N4O — CID 119379560
(3-aminopiperidin-1-yl)-(2-pyridin-4-ylquinolin-4-yl)methanone;dihydrochloride (PubChem CID 119379560) has the molecular formula C20H22Cl2N4O and a molecular weight of 405.33 g/mol. Its IUPAC name is (3-aminopiperidin-1-yl)-(2-pyridin-4-ylquinolin-4-yl)methanone;dihydrochloride.
| Compound Name | (3-aminopiperidin-1-yl)-(2-pyridin-4-ylquinolin-4-yl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 119379560 |
| Molecular Formula | C20H22Cl2N4O |
| Molecular Weight | 405.33 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | (3-aminopiperidin-1-yl)-(2-pyridin-4-ylquinolin-4-yl)methanone;dihydrochloride |
| SMILES | Cl.Cl.NC1CCCN(C(=O)c2cc(-c3ccncc3)nc3ccccc23)C1 |
| InChI | InChI=1S/C20H20N4O.2ClH/c21-15-4-3-11-24(13-15)20(25)17-12-19(14-7-9-22-10-8-14)23-18-6-2-1-5-16(17)18;;/h1-2,5-10,12,15H,3-4,11,13,21H2;2*1H |
| InChIKey | MVNHIODPSIPXMN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.33 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |