C24H27N3O — CID 119594358
[3-(1-aminoethyl)piperidin-1-yl]-[2-(4-methylphenyl)quinolin-4-yl]methanone (PubChem CID 119594358) has the molecular formula C24H27N3O and a molecular weight of 373.50 g/mol. Its IUPAC name is [3-(1-aminoethyl)piperidin-1-yl]-[2-(4-methylphenyl)quinolin-4-yl]methanone.
| Compound Name | [3-(1-aminoethyl)piperidin-1-yl]-[2-(4-methylphenyl)quinolin-4-yl]methanone |
|---|---|
| PubChem CID | 119594358 |
| Molecular Formula | C24H27N3O |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | [3-(1-aminoethyl)piperidin-1-yl]-[2-(4-methylphenyl)quinolin-4-yl]methanone |
| SMILES | Cc1ccc(-c2cc(C(=O)N3CCCC(C(C)N)C3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C24H27N3O/c1-16-9-11-18(12-10-16)23-14-21(20-7-3-4-8-22(20)26-23)24(28)27-13-5-6-19(15-27)17(2)25/h3-4,7-12,14,17,19H,5-6,13,15,25H2,1-2H3 |
| InChIKey | WNJWSZMKILYCQS-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |