C25H21N3O2 — CID 42653328
(2-phenylmorpholin-4-yl)-(2-pyridin-4-ylquinolin-4-yl)methanone (PubChem CID 42653328) has the molecular formula C25H21N3O2 and a molecular weight of 395.46 g/mol. Its IUPAC name is (2-phenylmorpholin-4-yl)-(2-pyridin-4-ylquinolin-4-yl)methanone.
| Compound Name | (2-phenylmorpholin-4-yl)-(2-pyridin-4-ylquinolin-4-yl)methanone |
|---|---|
| PubChem CID | 42653328 |
| Molecular Formula | C25H21N3O2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | (2-phenylmorpholin-4-yl)-(2-pyridin-4-ylquinolin-4-yl)methanone |
| SMILES | O=C(c1cc(-c2ccncc2)nc2ccccc12)N1CCOC(c2ccccc2)C1 |
| InChI | InChI=1S/C25H21N3O2/c29-25(28-14-15-30-24(17-28)19-6-2-1-3-7-19)21-16-23(18-10-12-26-13-11-18)27-22-9-5-4-8-20(21)22/h1-13,16,24H,14-15,17H2 |
| InChIKey | HSGPJUNMNIHSPU-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |