C26H24N2O4 — CID 97071310
[2-(4-methoxyphenyl)quinolin-4-yl]-[(2R)-2-(5-methylfuran-2-yl)morpholin-4-yl]methanone (PubChem CID 97071310) has the molecular formula C26H24N2O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)quinolin-4-yl]-[(2R)-2-(5-methylfuran-2-yl)morpholin-4-yl]methanone.
| Compound Name | [2-(4-methoxyphenyl)quinolin-4-yl]-[(2R)-2-(5-methylfuran-2-yl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 97071310 |
| Molecular Formula | C26H24N2O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | [2-(4-methoxyphenyl)quinolin-4-yl]-[(2R)-2-(5-methylfuran-2-yl)morpholin-4-yl]methanone |
| SMILES | COc1ccc(-c2cc(C(=O)N3CCO[C@@H](c4ccc(C)o4)C3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C26H24N2O4/c1-17-7-12-24(32-17)25-16-28(13-14-31-25)26(29)21-15-23(18-8-10-19(30-2)11-9-18)27-22-6-4-3-5-20(21)22/h3-12,15,25H,13-14,16H2,1-2H3/t25-/m1/s1 |
| InChIKey | GKQXDWYJPUUOIB-RUZDIDTESA-N |
| XLogP | 5.03 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |