C29H26N4O2 — CID 40973368
[(3R)-3-(1H-benzimidazol-2-yl)piperidin-1-yl]-[2-(4-methoxyphenyl)quinolin-4-yl]methanone (PubChem CID 40973368) has the molecular formula C29H26N4O2 and a molecular weight of 462.55 g/mol. Its IUPAC name is [(3R)-3-(1H-benzimidazol-2-yl)piperidin-1-yl]-[2-(4-methoxyphenyl)quinolin-4-yl]methanone.
| Compound Name | [(3R)-3-(1H-benzimidazol-2-yl)piperidin-1-yl]-[2-(4-methoxyphenyl)quinolin-4-yl]methanone |
|---|---|
| PubChem CID | 40973368 |
| Molecular Formula | C29H26N4O2 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | [(3R)-3-(1H-benzimidazol-2-yl)piperidin-1-yl]-[2-(4-methoxyphenyl)quinolin-4-yl]methanone |
| SMILES | COc1ccc(-c2cc(C(=O)N3CCC[C@@H](c4nc5ccccc5[nH]4)C3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C29H26N4O2/c1-35-21-14-12-19(13-15-21)27-17-23(22-8-2-3-9-24(22)30-27)29(34)33-16-6-7-20(18-33)28-31-25-10-4-5-11-26(25)32-28/h2-5,8-15,17,20H,6-7,16,18H2,1H3,(H,31,32)/t20-/m1/s1 |
| InChIKey | PEVHZQDLYOACJI-HXUWFJFHSA-N |
| XLogP | 5.81 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |