C22H25Cl2N3O2 — CID 119415935
1,4-diazepan-1-yl-[2-(4-methoxyphenyl)quinolin-4-yl]methanone;dihydrochloride (PubChem CID 119415935) has the molecular formula C22H25Cl2N3O2 and a molecular weight of 434.37 g/mol. Its IUPAC name is 1,4-diazepan-1-yl-[2-(4-methoxyphenyl)quinolin-4-yl]methanone;dihydrochloride.
| Compound Name | 1,4-diazepan-1-yl-[2-(4-methoxyphenyl)quinolin-4-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 119415935 |
| Molecular Formula | C22H25Cl2N3O2 |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 1,4-diazepan-1-yl-[2-(4-methoxyphenyl)quinolin-4-yl]methanone;dihydrochloride |
| SMILES | COc1ccc(-c2cc(C(=O)N3CCCNCC3)c3ccccc3n2)cc1.Cl.Cl |
| InChI | InChI=1S/C22H23N3O2.2ClH/c1-27-17-9-7-16(8-10-17)21-15-19(18-5-2-3-6-20(18)24-21)22(26)25-13-4-11-23-12-14-25;;/h2-3,5-10,15,23H,4,11-14H2,1H3;2*1H |
| InChIKey | ZYMKFFOIVVOOHR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |