C29H26N2O4 — CID 24615482
(4-hydroxyphenyl)-[1-[2-(4-methoxyphenyl)quinoline-4-carbonyl]piperidin-4-yl]methanone (PubChem CID 24615482) has the molecular formula C29H26N2O4 and a molecular weight of 466.54 g/mol. Its IUPAC name is (4-hydroxyphenyl)-[1-[2-(4-methoxyphenyl)quinoline-4-carbonyl]piperidin-4-yl]methanone.
| Compound Name | (4-hydroxyphenyl)-[1-[2-(4-methoxyphenyl)quinoline-4-carbonyl]piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 24615482 |
| Molecular Formula | C29H26N2O4 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | (4-hydroxyphenyl)-[1-[2-(4-methoxyphenyl)quinoline-4-carbonyl]piperidin-4-yl]methanone |
| SMILES | COc1ccc(-c2cc(C(=O)N3CCC(C(=O)c4ccc(O)cc4)CC3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C29H26N2O4/c1-35-23-12-8-19(9-13-23)27-18-25(24-4-2-3-5-26(24)30-27)29(34)31-16-14-21(15-17-31)28(33)20-6-10-22(32)11-7-20/h2-13,18,21,32H,14-17H2,1H3 |
| InChIKey | RPMVARQPEOQSSU-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |