C24H25N3O2 — CID 78779468
N,N-dimethyl-1-(2-phenylquinoline-4-carbonyl)piperidine-4-carboxamide (PubChem CID 78779468) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is N,N-dimethyl-1-(2-phenylquinoline-4-carbonyl)piperidine-4-carboxamide.
| Compound Name | N,N-dimethyl-1-(2-phenylquinoline-4-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 78779468 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | N,N-dimethyl-1-(2-phenylquinoline-4-carbonyl)piperidine-4-carboxamide |
| SMILES | CN(C)C(=O)C1CCN(C(=O)c2cc(-c3ccccc3)nc3ccccc23)CC1 |
| InChI | InChI=1S/C24H25N3O2/c1-26(2)23(28)18-12-14-27(15-13-18)24(29)20-16-22(17-8-4-3-5-9-17)25-21-11-7-6-10-19(20)21/h3-11,16,18H,12-15H2,1-2H3 |
| InChIKey | JTBIGXNIGREXRD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |