C34H31N3O2 — CID 4273485
(4-benzhydrylpiperazin-1-yl)-[2-(4-methoxyphenyl)quinolin-4-yl]methanone (PubChem CID 4273485) has the molecular formula C34H31N3O2 and a molecular weight of 513.64 g/mol. Its IUPAC name is (4-benzhydrylpiperazin-1-yl)-[2-(4-methoxyphenyl)quinolin-4-yl]methanone.
| Compound Name | (4-benzhydrylpiperazin-1-yl)-[2-(4-methoxyphenyl)quinolin-4-yl]methanone |
|---|---|
| PubChem CID | 4273485 |
| Molecular Formula | C34H31N3O2 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | (4-benzhydrylpiperazin-1-yl)-[2-(4-methoxyphenyl)quinolin-4-yl]methanone |
| SMILES | COc1ccc(-c2cc(C(=O)N3CCN(C(c4ccccc4)c4ccccc4)CC3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C34H31N3O2/c1-39-28-18-16-25(17-19-28)32-24-30(29-14-8-9-15-31(29)35-32)34(38)37-22-20-36(21-23-37)33(26-10-4-2-5-11-26)27-12-6-3-7-13-27/h2-19,24,33H,20-23H2,1H3 |
| InChIKey | PXJICSFQLPYNAU-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |