C32H29N3OS — CID 1010741
(4-benzhydrylpiperazin-1-yl)-[2-(5-methylthiophen-2-yl)quinolin-4-yl]methanone (PubChem CID 1010741) has the molecular formula C32H29N3OS and a molecular weight of 503.67 g/mol. Its IUPAC name is (4-benzhydrylpiperazin-1-yl)-[2-(5-methylthiophen-2-yl)quinolin-4-yl]methanone.
| Compound Name | (4-benzhydrylpiperazin-1-yl)-[2-(5-methylthiophen-2-yl)quinolin-4-yl]methanone |
|---|---|
| PubChem CID | 1010741 |
| Molecular Formula | C32H29N3OS |
| Molecular Weight | 503.67 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | (4-benzhydrylpiperazin-1-yl)-[2-(5-methylthiophen-2-yl)quinolin-4-yl]methanone |
| SMILES | Cc1ccc(-c2cc(C(=O)N3CCN(C(c4ccccc4)c4ccccc4)CC3)c3ccccc3n2)s1 |
| InChI | InChI=1S/C32H29N3OS/c1-23-16-17-30(37-23)29-22-27(26-14-8-9-15-28(26)33-29)32(36)35-20-18-34(19-21-35)31(24-10-4-2-5-11-24)25-12-6-3-7-13-25/h2-17,22,31H,18-21H2,1H3 |
| InChIKey | UDSBGEHFURODHB-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.67 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |