C20H20N2O2S — CID 35330795
[8-methyl-2-(5-methylthiophen-2-yl)quinolin-4-yl]-morpholin-4-ylmethanone (PubChem CID 35330795) has the molecular formula C20H20N2O2S and a molecular weight of 352.46 g/mol. Its IUPAC name is [8-methyl-2-(5-methylthiophen-2-yl)quinolin-4-yl]-morpholin-4-ylmethanone.
| Compound Name | [8-methyl-2-(5-methylthiophen-2-yl)quinolin-4-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 35330795 |
| Molecular Formula | C20H20N2O2S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | [8-methyl-2-(5-methylthiophen-2-yl)quinolin-4-yl]-morpholin-4-ylmethanone |
| SMILES | Cc1ccc(-c2cc(C(=O)N3CCOCC3)c3cccc(C)c3n2)s1 |
| InChI | InChI=1S/C20H20N2O2S/c1-13-4-3-5-15-16(20(23)22-8-10-24-11-9-22)12-17(21-19(13)15)18-7-6-14(2)25-18/h3-7,12H,8-11H2,1-2H3 |
| InChIKey | STLHESVNHSCYOT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |