C17H20N2O — CID 50765986
(2,8-dimethylquinolin-4-yl)-piperidin-1-ylmethanone (PubChem CID 50765986) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is (2,8-dimethylquinolin-4-yl)-piperidin-1-ylmethanone.
| Compound Name | (2,8-dimethylquinolin-4-yl)-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 50765986 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | (2,8-dimethylquinolin-4-yl)-piperidin-1-ylmethanone |
| SMILES | Cc1cc(C(=O)N2CCCCC2)c2cccc(C)c2n1 |
| InChI | InChI=1S/C17H20N2O/c1-12-7-6-8-14-15(11-13(2)18-16(12)14)17(20)19-9-4-3-5-10-19/h6-8,11H,3-5,9-10H2,1-2H3 |
| InChIKey | LXAALWGYYFOILJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |