C20H18N2O — CID 70719076
1,3-dihydroisoindol-2-yl-(2,8-dimethylquinolin-4-yl)methanone (PubChem CID 70719076) has the molecular formula C20H18N2O and a molecular weight of 302.38 g/mol. Its IUPAC name is 1,3-dihydroisoindol-2-yl-(2,8-dimethylquinolin-4-yl)methanone.
| Compound Name | 1,3-dihydroisoindol-2-yl-(2,8-dimethylquinolin-4-yl)methanone |
|---|---|
| PubChem CID | 70719076 |
| Molecular Formula | C20H18N2O |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 1,3-dihydroisoindol-2-yl-(2,8-dimethylquinolin-4-yl)methanone |
| SMILES | Cc1cc(C(=O)N2Cc3ccccc3C2)c2cccc(C)c2n1 |
| InChI | InChI=1S/C20H18N2O/c1-13-6-5-9-17-18(10-14(2)21-19(13)17)20(23)22-11-15-7-3-4-8-16(15)12-22/h3-10H,11-12H2,1-2H3 |
| InChIKey | YPXAUUSUJGUPIM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |